C18H28Cl3N3O3 — CID 119875833
(4-amino-5-chloro-2-methoxyphenyl)-[3-(morpholin-4-ylmethyl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119875833) has the molecular formula C18H28Cl3N3O3 and a molecular weight of 440.80 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[3-(morpholin-4-ylmethyl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(morpholin-4-ylmethyl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119875833 |
| Molecular Formula | C18H28Cl3N3O3 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(morpholin-4-ylmethyl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCCC(CN2CCOCC2)C1.Cl.Cl |
| InChI | InChI=1S/C18H26ClN3O3.2ClH/c1-24-17-10-16(20)15(19)9-14(17)18(23)22-4-2-3-13(12-22)11-21-5-7-25-8-6-21;;/h9-10,13H,2-8,11-12,20H2,1H3;2*1H |
| InChIKey | UWNPXXMMAQBVMH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|