C14H16ClF3N2O2 — CID 119682788
(4-amino-5-chloro-2-methoxyphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 119682788) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119682788 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-22-12-6-11(19)10(15)5-9(12)13(21)20-4-2-3-8(7-20)14(16,17)18/h5-6,8H,2-4,7,19H2,1H3 |
| InChIKey | SSOYALOGTJHCJN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|