C18H18F3NO2 — CID 25161591
(3-methoxynaphthalen-2-yl)-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 25161591) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (3-methoxynaphthalen-2-yl)-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (3-methoxynaphthalen-2-yl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 25161591 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3-methoxynaphthalen-2-yl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | COc1cc2ccccc2cc1C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H18F3NO2/c1-24-16-10-13-6-3-2-5-12(13)9-15(16)17(23)22-8-4-7-14(11-22)18(19,20)21/h2-3,5-6,9-10,14H,4,7-8,11H2,1H3 |
| InChIKey | HXALUEWPQDMVKI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |