C13H18ClN3O4S — CID 119793545
N-[1-(4-amino-5-chloro-2-methoxybenzoyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 119793545) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is N-[1-(4-amino-5-chloro-2-methoxybenzoyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(4-amino-5-chloro-2-methoxybenzoyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 119793545 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[1-(4-amino-5-chloro-2-methoxybenzoyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCC(NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H18ClN3O4S/c1-21-12-6-11(15)10(14)5-9(12)13(18)17-4-3-8(7-17)16-22(2,19)20/h5-6,8,16H,3-4,7,15H2,1-2H3 |
| InChIKey | SQCWRNDRLVSUJD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|