C18H23ClN4O2S — CID 119864369
(4-amino-5-chloro-2-methoxyphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 119864369) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119864369 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | CCc1nc(CN2CCN(C(=O)c3cc(Cl)c(N)cc3OC)CC2)cs1 |
| InChI | InChI=1S/C18H23ClN4O2S/c1-3-17-21-12(11-26-17)10-22-4-6-23(7-5-22)18(24)13-8-14(19)15(20)9-16(13)25-2/h8-9,11H,3-7,10,20H2,1-2H3 |
| InChIKey | JZNOFVZEIKBJMU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|