C17H18ClN7O2 — CID 119879800
(4-amino-5-chloro-2-methoxyphenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone (PubChem CID 119879800) has the molecular formula C17H18ClN7O2 and a molecular weight of 387.83 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119879800 |
| Molecular Formula | C17H18ClN7O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCN(c2ccc3nncn3n2)CC1 |
| InChI | InChI=1S/C17H18ClN7O2/c1-27-14-9-13(19)12(18)8-11(14)17(26)24-6-4-23(5-7-24)16-3-2-15-21-20-10-25(15)22-16/h2-3,8-10H,4-7,19H2,1H3 |
| InChIKey | HIJPIYHEWWOAMX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|