C16H19Cl2N7O — CID 119879787
(3-aminophenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119879787) has the molecular formula C16H19Cl2N7O and a molecular weight of 396.28 g/mol. Its IUPAC name is (3-aminophenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119879787 |
| Molecular Formula | C16H19Cl2N7O |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (3-aminophenyl)-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCN(c3ccc4nncn4n3)CC2)c1 |
| InChI | InChI=1S/C16H17N7O.2ClH/c17-13-3-1-2-12(10-13)16(24)22-8-6-21(7-9-22)15-5-4-14-19-18-11-23(14)20-15;;/h1-5,10-11H,6-9,17H2;2*1H |
| InChIKey | YCAHGSDYGIOQSD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|