C16H18ClN5O2 — CID 119854137
(4-amino-5-chloro-2-methoxyphenyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 119854137) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119854137 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C16H18ClN5O2/c1-24-14-9-13(18)12(17)8-11(14)16(23)22-6-4-21(5-7-22)15-10-19-2-3-20-15/h2-3,8-10H,4-7,18H2,1H3 |
| InChIKey | AKZBMXHUCYPYAH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|