C18H21Cl2N5O3 — CID 10741078
2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 10741078) has the molecular formula C18H21Cl2N5O3 and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | 2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 10741078 |
| Molecular Formula | C18H21Cl2N5O3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCCN1CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C18H21Cl2N5O3/c1-27-15-11-14(21)13(19)10-12(15)18(26)28-9-8-24-4-6-25(7-5-24)17-3-2-16(20)22-23-17/h2-3,10-11H,4-9,21H2,1H3 |
| InChIKey | PEOVPQPILOWMQF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|