C24H36ClN3O4 — CID 42625493
2-[4-(3-cyclohexylpropanoylamino)piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 42625493) has the molecular formula C24H36ClN3O4 and a molecular weight of 466.02 g/mol. Its IUPAC name is 2-[4-(3-cyclohexylpropanoylamino)piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | 2-[4-(3-cyclohexylpropanoylamino)piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 42625493 |
| Molecular Formula | C24H36ClN3O4 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[4-(3-cyclohexylpropanoylamino)piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCCN1CCC(NC(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C24H36ClN3O4/c1-31-22-16-21(26)20(25)15-19(22)24(30)32-14-13-28-11-9-18(10-12-28)27-23(29)8-7-17-5-3-2-4-6-17/h15-18H,2-14,26H2,1H3,(H,27,29) |
| InChIKey | MWRPXZDYPLKJHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|