C21H33ClN2O2 — CID 19081962
1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-hexylpiperidin-4-yl)propan-1-one (PubChem CID 19081962) has the molecular formula C21H33ClN2O2 and a molecular weight of 380.96 g/mol. Its IUPAC name is 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-hexylpiperidin-4-yl)propan-1-one.
| Compound Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-hexylpiperidin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 19081962 |
| Molecular Formula | C21H33ClN2O2 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-hexylpiperidin-4-yl)propan-1-one |
| SMILES | CCCCCCN1CCC(CCC(=O)c2cc(Cl)c(N)cc2OC)CC1 |
| InChI | InChI=1S/C21H33ClN2O2/c1-3-4-5-6-11-24-12-9-16(10-13-24)7-8-20(25)17-14-18(22)19(23)15-21(17)26-2/h14-16H,3-13,23H2,1-2H3 |
| InChIKey | MXDVWWZJULUKCA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|