C25H34ClN3O5S — CID 162649188
N-[3-[4-[3-(4-amino-5-chloro-2-methoxyphenyl)-3-oxopropyl]piperidin-1-yl]propyl]-4-methoxybenzenesulfonamide (PubChem CID 162649188) has the molecular formula C25H34ClN3O5S and a molecular weight of 524.08 g/mol. Its IUPAC name is N-[3-[4-[3-(4-amino-5-chloro-2-methoxyphenyl)-3-oxopropyl]piperidin-1-yl]propyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-[4-[3-(4-amino-5-chloro-2-methoxyphenyl)-3-oxopropyl]piperidin-1-yl]propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 162649188 |
| Molecular Formula | C25H34ClN3O5S |
| Molecular Weight | 524.08 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | N-[3-[4-[3-(4-amino-5-chloro-2-methoxyphenyl)-3-oxopropyl]piperidin-1-yl]propyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN2CCC(CCC(=O)c3cc(Cl)c(N)cc3OC)CC2)cc1 |
| InChI | InChI=1S/C25H34ClN3O5S/c1-33-19-5-7-20(8-6-19)35(31,32)28-12-3-13-29-14-10-18(11-15-29)4-9-24(30)21-16-22(26)23(27)17-25(21)34-2/h5-8,16-18,28H,3-4,9-15,27H2,1-2H3 |
| InChIKey | XYUNOSQVXMZGGS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|