C20H32Cl2N2O2 — CID 19081841
1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-pentylpiperidin-4-yl)propan-1-one;hydrochloride (PubChem CID 19081841) has the molecular formula C20H32Cl2N2O2 and a molecular weight of 403.39 g/mol. Its IUPAC name is 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-pentylpiperidin-4-yl)propan-1-one;hydrochloride.
| Compound Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-pentylpiperidin-4-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 19081841 |
| Molecular Formula | C20H32Cl2N2O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-pentylpiperidin-4-yl)propan-1-one;hydrochloride |
| SMILES | CCCCCN1CCC(CCC(=O)c2cc(Cl)c(N)cc2OC)CC1.Cl |
| InChI | InChI=1S/C20H31ClN2O2.ClH/c1-3-4-5-10-23-11-8-15(9-12-23)6-7-19(24)16-13-17(21)18(22)14-20(16)25-2;/h13-15H,3-12,22H2,1-2H3;1H |
| InChIKey | VIERYLPGBSFCDV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|