C23H34ClN3O4 — CID 42625406
2-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 42625406) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | 2-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 42625406 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-[4-[(2-cyclohexylacetyl)amino]piperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCCN1CCC(NC(=O)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34ClN3O4/c1-30-21-15-20(25)19(24)14-18(21)23(29)31-12-11-27-9-7-17(8-10-27)26-22(28)13-16-5-3-2-4-6-16/h14-17H,2-13,25H2,1H3,(H,26,28) |
| InChIKey | JURAATJIXSLACL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|