C21H27N3O2S — CID 94650670
(E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one (PubChem CID 94650670) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 94650670 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (E)-1-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one |
| SMILES | CCc1nc(CN2CCN(C(=O)/C=C/c3cc(C)ccc3OC)CC2)cs1 |
| InChI | InChI=1S/C21H27N3O2S/c1-4-20-22-18(15-27-20)14-23-9-11-24(12-10-23)21(25)8-6-17-13-16(2)5-7-19(17)26-3/h5-8,13,15H,4,9-12,14H2,1-3H3/b8-6+ |
| InChIKey | XPZAQBHNMOUANU-SOFGYWHQSA-N |
| XLogP | 3.38 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|