C14H20Cl2F3N3O — CID 119844309
(3-aminophenyl)-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride (PubChem CID 119844309) has the molecular formula C14H20Cl2F3N3O and a molecular weight of 374.23 g/mol. Its IUPAC name is (3-aminophenyl)-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119844309 |
| Molecular Formula | C14H20Cl2F3N3O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (3-aminophenyl)-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCCN(CC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C14H18F3N3O.2ClH/c15-14(16,17)10-19-5-2-6-20(8-7-19)13(21)11-3-1-4-12(18)9-11;;/h1,3-4,9H,2,5-8,10,18H2;2*1H |
| InChIKey | TWAOKCLJGVFTQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|