C18H18NP — CID 44726115
8-methyl-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole (PubChem CID 44726115) has the molecular formula C18H18NP and a molecular weight of 279.32 g/mol. Its IUPAC name is 8-methyl-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole.
| Compound Name | 8-methyl-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole |
|---|---|
| PubChem CID | 44726115 |
| Molecular Formula | C18H18NP |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 8-methyl-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CP(c1ccccc1)CC3 |
| InChI | InChI=1S/C18H18NP/c1-13-7-8-17-15(11-13)16-12-20(10-9-18(16)19-17)14-5-3-2-4-6-14/h2-8,11,19H,9-10,12H2,1H3 |
| InChIKey | MMXPNUHHVMYRLU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|