C27H28N2O — CID 10386070
10-[3-(4-phenylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 10386070) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 10-[3-(4-phenylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | 10-[3-(4-phenylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 10386070 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 10-[3-(4-phenylphenoxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | c1ccc(-c2ccc(OCCCc3cccc4[nH]c5c(c34)CCNCC5)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-2-6-20(7-3-1)21-11-13-23(14-12-21)30-19-5-9-22-8-4-10-26-27(22)24-15-17-28-18-16-25(24)29-26/h1-4,6-8,10-14,28-29H,5,9,15-19H2 |
| InChIKey | XCLSPFKEDXVBHG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|