C21H20Cl2N2O3 — CID 22396608
6-[2-(1,3-benzodioxol-5-yloxy)ethyl]-7,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 22396608) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is 6-[2-(1,3-benzodioxol-5-yloxy)ethyl]-7,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 6-[2-(1,3-benzodioxol-5-yloxy)ethyl]-7,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 22396608 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 6-[2-(1,3-benzodioxol-5-yloxy)ethyl]-7,10-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | Clc1ccc(Cl)c2c1c1c(n2CCOc2ccc3c(c2)OCO3)CCNCC1 |
| InChI | InChI=1S/C21H20Cl2N2O3/c22-15-2-3-16(23)21-20(15)14-5-7-24-8-6-17(14)25(21)9-10-26-13-1-4-18-19(11-13)28-12-27-18/h1-4,11,24H,5-10,12H2 |
| InChIKey | DNGHBQUKYKWFQA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |