C23H20N2 — CID 142130689
5-(3-phenylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 142130689) has the molecular formula C23H20N2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-(3-phenylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 5-(3-phenylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 142130689 |
| Molecular Formula | C23H20N2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-(3-phenylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2cccc(-c3cccc4[nH]c5c(c34)CCNC5)c2)cc1 |
| InChI | InChI=1S/C23H20N2/c1-2-6-16(7-3-1)17-8-4-9-18(14-17)19-10-5-11-21-23(19)20-12-13-24-15-22(20)25-21/h1-11,14,24-25H,12-13,15H2 |
| InChIKey | JICLKTIBGKJANK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |