C19H17N — CID 81230530
7-naphthalen-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 81230530) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 7-naphthalen-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-naphthalen-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81230530 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 7-naphthalen-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2cc(-c3ccc4c(c3)NCCC4)ccc2c1 |
| InChI | InChI=1S/C19H17N/c1-2-5-16-12-17(9-7-14(16)4-1)18-10-8-15-6-3-11-20-19(15)13-18/h1-2,4-5,7-10,12-13,20H,3,6,11H2 |
| InChIKey | HMMRXDJBVJTJRA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |