C18H21NO — CID 106781897
7-(2-methoxy-4,6-dimethylphenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106781897) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 7-(2-methoxy-4,6-dimethylphenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(2-methoxy-4,6-dimethylphenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106781897 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 7-(2-methoxy-4,6-dimethylphenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc(C)cc(C)c1-c1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C18H21NO/c1-12-9-13(2)18(17(10-12)20-3)15-7-6-14-5-4-8-19-16(14)11-15/h6-7,9-11,19H,4-5,8H2,1-3H3 |
| InChIKey | IDFWNJFVJJWYRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |