C17H19NO2 — CID 81224636
7-(2,4-dimethoxyphenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 81224636) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 7-(2,4-dimethoxyphenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(2,4-dimethoxyphenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81224636 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc(-c2ccc3c(c2)NCCC3)c(OC)c1 |
| InChI | InChI=1S/C17H19NO2/c1-19-14-7-8-15(17(11-14)20-2)13-6-5-12-4-3-9-18-16(12)10-13/h5-8,10-11,18H,3-4,9H2,1-2H3 |
| InChIKey | MAJIOGFRYRMVPD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |