About 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid
4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid (PubChem CID 117110506) has the molecular formula C9H8FNO3
and a molecular weight of 197.16 g/mol. Its IUPAC name is 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid.
Analyze 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid?
The IUPAC name of 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid (CID 117110506) is 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid.
What is the SMILES notation for 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid?
The canonical SMILES for 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid is O=C(O)c1c(O)cc2c(c1F)CCN2.
What is the InChIKey of 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid?
The InChIKey is FQDGXXJRFSRDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO3/c10-8-4-1-2-11-5(4)3-6(12)7(8)9(13)14/h3,11-12H,1-2H2,(H,13,14).
What are the key properties of 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid?
4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid has a molecular weight of 197.16 g/mol, XLogP of 1.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-6-hydroxy-2,3-dihydro-1H-indole-5-carboxylic acid is sourced from PubChem (CID 117110506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).