C8H8INO — CID 119083614
6-iodo-2,3-dihydro-1H-indol-4-ol (PubChem CID 119083614) has the molecular formula C8H8INO and a molecular weight of 261.06 g/mol. Its IUPAC name is 6-iodo-2,3-dihydro-1H-indol-4-ol.
| Compound Name | 6-iodo-2,3-dihydro-1H-indol-4-ol |
|---|---|
| PubChem CID | 119083614 |
| Molecular Formula | C8H8INO |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 6-iodo-2,3-dihydro-1H-indol-4-ol |
| SMILES | Oc1cc(I)cc2c1CCN2 |
| InChI | InChI=1S/C8H8INO/c9-5-3-7-6(1-2-10-7)8(11)4-5/h3-4,10-11H,1-2H2 |
| InChIKey | VWXSMSDTXHMPKL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|