4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid

C10H11NO3 — CID 167722989

IUPAC4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESO=C(O)c1cc(CO)c2c(c1)NCC2
InChIInChI=1S/C10H11NO3/c12-5-7-3-6(10(13)14)4-9-8(7)1-2-11-9/h3-4,11-12H,1-2,5H2,(H,13,14)
InChIKeyGWWCJXPXPHLZCO-UHFFFAOYSA-N
MW193.20 g/mol
LogP0.85
Rot. Bonds2

About 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid

4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 167722989) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid.

Molecular Properties

Compound Name4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid
PubChem CID167722989
Molecular FormulaC10H11NO3
Molecular Weight193.20 g/mol
Exact Mass193.07
IUPAC Name4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESO=C(O)c1cc(CO)c2c(c1)NCC2
InChIInChI=1S/C10H11NO3/c12-5-7-3-6(10(13)14)4-9-8(7)1-2-11-9/h3-4,11-12H,1-2,5H2,(H,13,14)
InChIKeyGWWCJXPXPHLZCO-UHFFFAOYSA-N
XLogP0.85
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.20
LogP ≤ 50.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid?
The IUPAC name of 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid (CID 167722989) is 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid.
What is the SMILES notation for 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid?
The canonical SMILES for 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid is O=C(O)c1cc(CO)c2c(c1)NCC2.
What is the InChIKey of 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid?
The InChIKey is GWWCJXPXPHLZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c12-5-7-3-6(10(13)14)4-9-8(7)1-2-11-9/h3-4,11-12H,1-2,5H2,(H,13,14).
What are the key properties of 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid?
4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid has a molecular weight of 193.20 g/mol, XLogP of 0.85, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,3-dihydro-1H-indole-6-carboxylic acid is sourced from PubChem (CID 167722989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).