C15H18ClNO — CID 143754973
chloromethane;9-ethyl-2,3-dihydro-1H-benzo[e]indol-5-ol (PubChem CID 143754973) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is chloromethane;9-ethyl-2,3-dihydro-1H-benzo[e]indol-5-ol.
| Compound Name | chloromethane;9-ethyl-2,3-dihydro-1H-benzo[e]indol-5-ol |
|---|---|
| PubChem CID | 143754973 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | chloromethane;9-ethyl-2,3-dihydro-1H-benzo[e]indol-5-ol |
| SMILES | CCc1cccc2c(O)cc3c(c12)CCN3.CCl |
| InChI | InChI=1S/C14H15NO.CH3Cl/c1-2-9-4-3-5-11-13(16)8-12-10(14(9)11)6-7-15-12;1-2/h3-5,8,15-16H,2,6-7H2,1H3;1H3 |
| InChIKey | JRISRCWDDGZQPA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|