C20H25N — CID 116698620
4-(2,4,6-triethylphenyl)-2,3-dihydro-1H-indole (PubChem CID 116698620) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-(2,4,6-triethylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(2,4,6-triethylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698620 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 4-(2,4,6-triethylphenyl)-2,3-dihydro-1H-indole |
| SMILES | CCc1cc(CC)c(-c2cccc3c2CCN3)c(CC)c1 |
| InChI | InChI=1S/C20H25N/c1-4-14-12-15(5-2)20(16(6-3)13-14)18-8-7-9-19-17(18)10-11-21-19/h7-9,12-13,21H,4-6,10-11H2,1-3H3 |
| InChIKey | SCMLUBLJVYCPEY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |