C30H37I — CID 163342457
1,3,5-triethyl-2-[2-iodo-3-(2,4,6-triethylphenyl)phenyl]benzene (PubChem CID 163342457) has the molecular formula C30H37I and a molecular weight of 524.53 g/mol. Its IUPAC name is 1,3,5-triethyl-2-[2-iodo-3-(2,4,6-triethylphenyl)phenyl]benzene.
| Compound Name | 1,3,5-triethyl-2-[2-iodo-3-(2,4,6-triethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 163342457 |
| Molecular Formula | C30H37I |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 1,3,5-triethyl-2-[2-iodo-3-(2,4,6-triethylphenyl)phenyl]benzene |
| SMILES | CCc1cc(CC)c(-c2cccc(-c3c(CC)cc(CC)cc3CC)c2I)c(CC)c1 |
| InChI | InChI=1S/C30H37I/c1-7-20-16-22(9-3)28(23(10-4)17-20)26-14-13-15-27(30(26)31)29-24(11-5)18-21(8-2)19-25(29)12-6/h13-19H,7-12H2,1-6H3 |
| InChIKey | ZLBGOUKTPCFPSB-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|