C16H16 — CID 134993289
2,3-diethylbiphenylene (PubChem CID 134993289) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3-diethylbiphenylene.
| Compound Name | 2,3-diethylbiphenylene |
|---|---|
| PubChem CID | 134993289 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,3-diethylbiphenylene |
| SMILES | CCc1cc2c(cc1CC)-c1ccccc1-2 |
| InChI | InChI=1S/C16H16/c1-3-11-9-15-13-7-5-6-8-14(13)16(15)10-12(11)4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | GSJBBYKOEBMASK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |