C10H10N2O4 — CID 91566156
3,4-dihydro-2H-quinoxaline-1,6-dicarboxylic acid (PubChem CID 91566156) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinoxaline-1,6-dicarboxylic acid.
| Compound Name | 3,4-dihydro-2H-quinoxaline-1,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91566156 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3,4-dihydro-2H-quinoxaline-1,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)NCCN2C(=O)O |
| InChI | InChI=1S/C10H10N2O4/c13-9(14)6-1-2-8-7(5-6)11-3-4-12(8)10(15)16/h1-2,5,11H,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | VKPVIEAORXNXIG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |