C14H19N3O2 — CID 117030660
4-piperidin-4-yl-2,3-dihydro-1H-quinoxaline-6-carboxylic acid (PubChem CID 117030660) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-piperidin-4-yl-2,3-dihydro-1H-quinoxaline-6-carboxylic acid.
| Compound Name | 4-piperidin-4-yl-2,3-dihydro-1H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 117030660 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-piperidin-4-yl-2,3-dihydro-1H-quinoxaline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)N(C1CCNCC1)CCN2 |
| InChI | InChI=1S/C14H19N3O2/c18-14(19)10-1-2-12-13(9-10)17(8-7-16-12)11-3-5-15-6-4-11/h1-2,9,11,15-16H,3-8H2,(H,18,19) |
| InChIKey | LJGHFGOAMSEFKL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |