5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid

C11H14N2O2 — CID 83820018

IUPAC5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid
SMILESCN1CCCNc2ccc(C(=O)O)cc21
InChIInChI=1S/C11H14N2O2/c1-13-6-2-5-12-9-4-3-8(11(14)15)7-10(9)13/h3-4,7,12H,2,5-6H2,1H3,(H,14,15)
InChIKeyWDVHPAMOTFZOBN-UHFFFAOYSA-N
MW206.25 g/mol
LogP1.64
Rot. Bonds1

About 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid

5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid (PubChem CID 83820018) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid.

Molecular Properties

Compound Name5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid
PubChem CID83820018
Molecular FormulaC11H14N2O2
Molecular Weight206.25 g/mol
Exact Mass206.11
IUPAC Name5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid
SMILESCN1CCCNc2ccc(C(=O)O)cc21
InChIInChI=1S/C11H14N2O2/c1-13-6-2-5-12-9-4-3-8(11(14)15)7-10(9)13/h3-4,7,12H,2,5-6H2,1H3,(H,14,15)
InChIKeyWDVHPAMOTFZOBN-UHFFFAOYSA-N
XLogP1.64
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.25
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid?
The IUPAC name of 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid (CID 83820018) is 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid.
What is the SMILES notation for 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid?
The canonical SMILES for 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid is CN1CCCNc2ccc(C(=O)O)cc21.
What is the InChIKey of 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid?
The InChIKey is WDVHPAMOTFZOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-13-6-2-5-12-9-4-3-8(11(14)15)7-10(9)13/h3-4,7,12H,2,5-6H2,1H3,(H,14,15).
What are the key properties of 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid?
5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid has a molecular weight of 206.25 g/mol, XLogP of 1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-7-carboxylic acid is sourced from PubChem (CID 83820018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).