4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid

C12H17N3O2 — CID 117030646

IUPAC4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid
SMILESCC(N)CN1CCNc2ccc(C(=O)O)cc21
InChIInChI=1S/C12H17N3O2/c1-8(13)7-15-5-4-14-10-3-2-9(12(16)17)6-11(10)15/h2-3,6,8,14H,4-5,7,13H2,1H3,(H,16,17)
InChIKeyOXFLOJQPVBIHDN-UHFFFAOYSA-N
MW235.29 g/mol
LogP0.96
Rot. Bonds3

About 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid

4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid (PubChem CID 117030646) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid.

Molecular Properties

Compound Name4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid
PubChem CID117030646
Molecular FormulaC12H17N3O2
Molecular Weight235.29 g/mol
Exact Mass235.13
IUPAC Name4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid
SMILESCC(N)CN1CCNc2ccc(C(=O)O)cc21
InChIInChI=1S/C12H17N3O2/c1-8(13)7-15-5-4-14-10-3-2-9(12(16)17)6-11(10)15/h2-3,6,8,14H,4-5,7,13H2,1H3,(H,16,17)
InChIKeyOXFLOJQPVBIHDN-UHFFFAOYSA-N
XLogP0.96
TPSA78.59 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.29
LogP ≤ 50.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid?
The IUPAC name of 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid (CID 117030646) is 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid.
What is the SMILES notation for 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid?
The canonical SMILES for 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid is CC(N)CN1CCNc2ccc(C(=O)O)cc21.
What is the InChIKey of 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid?
The InChIKey is OXFLOJQPVBIHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-8(13)7-15-5-4-14-10-3-2-9(12(16)17)6-11(10)15/h2-3,6,8,14H,4-5,7,13H2,1H3,(H,16,17).
What are the key properties of 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid?
4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid has a molecular weight of 235.29 g/mol, XLogP of 0.96, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)-2,3-dihydro-1H-quinoxaline-6-carboxylic acid is sourced from PubChem (CID 117030646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).