C14H18N4 — CID 117031626
1-piperidin-4-yl-3,4-dihydro-2H-quinoxaline-6-carbonitrile (PubChem CID 117031626) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 1-piperidin-4-yl-3,4-dihydro-2H-quinoxaline-6-carbonitrile.
| Compound Name | 1-piperidin-4-yl-3,4-dihydro-2H-quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 117031626 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-piperidin-4-yl-3,4-dihydro-2H-quinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NCCN2C1CCNCC1 |
| InChI | InChI=1S/C14H18N4/c15-10-11-1-2-14-13(9-11)17-7-8-18(14)12-3-5-16-6-4-12/h1-2,9,12,16-17H,3-8H2 |
| InChIKey | CTFGOGDQHHRIAL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |