C11H13N3S — CID 117031652
1-(2-sulfanylethyl)-3,4-dihydro-2H-quinoxaline-6-carbonitrile (PubChem CID 117031652) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(2-sulfanylethyl)-3,4-dihydro-2H-quinoxaline-6-carbonitrile.
| Compound Name | 1-(2-sulfanylethyl)-3,4-dihydro-2H-quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 117031652 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(2-sulfanylethyl)-3,4-dihydro-2H-quinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NCCN2CCS |
| InChI | InChI=1S/C11H13N3S/c12-8-9-1-2-11-10(7-9)13-3-4-14(11)5-6-15/h1-2,7,13,15H,3-6H2 |
| InChIKey | QBRCQOSWMFRGMV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|