C10H13NO2 — CID 90841519
2,3,4,5-tetrahydro-1H-1-benzazepine-7,8-diol (PubChem CID 90841519) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-1-benzazepine-7,8-diol.
| Compound Name | 2,3,4,5-tetrahydro-1H-1-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 90841519 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-1-benzazepine-7,8-diol |
| SMILES | Oc1cc2c(cc1O)NCCCC2 |
| InChI | InChI=1S/C10H13NO2/c12-9-5-7-3-1-2-4-11-8(7)6-10(9)13/h5-6,11-13H,1-4H2 |
| InChIKey | GVYIETYVDWMKHD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|