C9H10O2 — CID 13058959
2,3-dihydro-1H-indene-5,6-diol (PubChem CID 13058959) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-5,6-diol.
| Compound Name | 2,3-dihydro-1H-indene-5,6-diol |
|---|---|
| PubChem CID | 13058959 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2,3-dihydro-1H-indene-5,6-diol |
| SMILES | Oc1cc2c(cc1O)CCC2 |
| InChI | InChI=1S/C9H10O2/c10-8-4-6-2-1-3-7(6)5-9(8)11/h4-5,10-11H,1-3H2 |
| InChIKey | MYGHRGDHIRSOKL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|