About 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol
6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 117277759) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 117277759 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | OCCc1cc2c(cc1O)CCC2 |
| InChI | InChI=1S/C11H14O2/c12-5-4-10-6-8-2-1-3-9(8)7-11(10)13/h6-7,12-13H,1-5H2 |
| InChIKey | OUWVYGGSGWSJNA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol (CID 117277759) is 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol is OCCc1cc2c(cc1O)CCC2.
What is the InChIKey of 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is OUWVYGGSGWSJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-5-4-10-6-8-2-1-3-9(8)7-11(10)13/h6-7,12-13H,1-5H2.
What are the key properties of 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol?
6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 178.23 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxyethyl)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 117277759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).