C11H13ClO — CID 117286528
2-(6-chloro-2,3-dihydro-1H-inden-4-yl)ethanol (PubChem CID 117286528) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydro-1H-inden-4-yl)ethanol.
| Compound Name | 2-(6-chloro-2,3-dihydro-1H-inden-4-yl)ethanol |
|---|---|
| PubChem CID | 117286528 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(6-chloro-2,3-dihydro-1H-inden-4-yl)ethanol |
| SMILES | OCCc1cc(Cl)cc2c1CCC2 |
| InChI | InChI=1S/C11H13ClO/c12-10-6-8-2-1-3-11(8)9(7-10)4-5-13/h6-7,13H,1-5H2 |
| InChIKey | YRSZCSRYMYPDKM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |