C13H18O2 — CID 117295060
2-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol (PubChem CID 117295060) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol.
| Compound Name | 2-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 117295060 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(1-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
| SMILES | COc1c(CCO)ccc2c1CCCC2 |
| InChI | InChI=1S/C13H18O2/c1-15-13-11(8-9-14)7-6-10-4-2-3-5-12(10)13/h6-7,14H,2-5,8-9H2,1H3 |
| InChIKey | VFKADHHSFJGNMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |