C11H15ClN2 — CID 53402162
(3-chloro-5,6,7,8-tetrahydronaphthalen-1-yl)methylhydrazine (PubChem CID 53402162) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is (3-chloro-5,6,7,8-tetrahydronaphthalen-1-yl)methylhydrazine.
| Compound Name | (3-chloro-5,6,7,8-tetrahydronaphthalen-1-yl)methylhydrazine |
|---|---|
| PubChem CID | 53402162 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3-chloro-5,6,7,8-tetrahydronaphthalen-1-yl)methylhydrazine |
| SMILES | NNCc1cc(Cl)cc2c1CCCC2 |
| InChI | InChI=1S/C11H15ClN2/c12-10-5-8-3-1-2-4-11(8)9(6-10)7-14-13/h5-6,14H,1-4,7,13H2 |
| InChIKey | RWJSXCNLZLWPDA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|