C11H13Cl2N — CID 12533018
1,3-dichloro-5,6,7,8,9,10-hexahydrocycloocta[c]pyridine (PubChem CID 12533018) has the molecular formula C11H13Cl2N and a molecular weight of 230.14 g/mol. Its IUPAC name is 1,3-dichloro-5,6,7,8,9,10-hexahydrocycloocta[c]pyridine.
| Compound Name | 1,3-dichloro-5,6,7,8,9,10-hexahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 12533018 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1,3-dichloro-5,6,7,8,9,10-hexahydrocycloocta[c]pyridine |
| SMILES | Clc1cc2c(c(Cl)n1)CCCCCC2 |
| InChI | InChI=1S/C11H13Cl2N/c12-10-7-8-5-3-1-2-4-6-9(8)11(13)14-10/h7H,1-6H2 |
| InChIKey | QDLUEHZJWYEZNR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|