C10H12S2 — CID 167495652
5,6,7,8-tetrahydronaphthalene-1,3-dithiol (PubChem CID 167495652) has the molecular formula C10H12S2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalene-1,3-dithiol.
| Compound Name | 5,6,7,8-tetrahydronaphthalene-1,3-dithiol |
|---|---|
| PubChem CID | 167495652 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalene-1,3-dithiol |
| SMILES | Sc1cc(S)c2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12S2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h5-6,11-12H,1-4H2 |
| InChIKey | RYJLPBDLRBKLCM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|