C14H19BO2 — CID 142716441
1,2,3,4,5,6,7,8-octahydrophenanthren-9-ylboronic acid (PubChem CID 142716441) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octahydrophenanthren-9-ylboronic acid.
| Compound Name | 1,2,3,4,5,6,7,8-octahydrophenanthren-9-ylboronic acid |
|---|---|
| PubChem CID | 142716441 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octahydrophenanthren-9-ylboronic acid |
| SMILES | OB(O)c1cc2c(c3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C14H19BO2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h9,16-17H,1-8H2 |
| InChIKey | UBHPTYFHNGNKTB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|