C16H21ClN2 — CID 63460303
2-chloro-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[b]pyridine-3-carbonitrile (PubChem CID 63460303) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 2-chloro-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[b]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 63460303 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-chloro-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1Cl)CCCCCCCCCC2 |
| InChI | InChI=1S/C16H21ClN2/c17-16-14(12-18)11-13-9-7-5-3-1-2-4-6-8-10-15(13)19-16/h11H,1-10H2 |
| InChIKey | YUIHDXRMAKGJAR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|