C10H7ClN2O — CID 84674722
2-chloro-6-oxo-7,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 84674722) has the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. Its IUPAC name is 2-chloro-6-oxo-7,8-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | 2-chloro-6-oxo-7,8-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 84674722 |
| Molecular Formula | C10H7ClN2O |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 2-chloro-6-oxo-7,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1Cl)CCC(=O)C2 |
| InChI | InChI=1S/C10H7ClN2O/c11-10-7(5-12)3-6-4-8(14)1-2-9(6)13-10/h3H,1-2,4H2 |
| InChIKey | XJWIAOOXIFBOOV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|