C15H20ClN3O2 — CID 143871007
ethane;ethyl 2-chloro-3-cyano-5-methyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (PubChem CID 143871007) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is ethane;ethyl 2-chloro-3-cyano-5-methyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate.
| Compound Name | ethane;ethyl 2-chloro-3-cyano-5-methyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 143871007 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethane;ethyl 2-chloro-3-cyano-5-methyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| SMILES | CC.CCOC(=O)N1CCc2nc(Cl)c(C#N)cc2C1C |
| InChI | InChI=1S/C13H14ClN3O2.C2H6/c1-3-19-13(18)17-5-4-11-10(8(17)2)6-9(7-15)12(14)16-11;1-2/h6,8H,3-5H2,1-2H3;1-2H3 |
| InChIKey | YSPJLPVVMMCHQG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|