C18H23ClFN3O2 — CID 154505737
ethyl (3R)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-4-cyclopentylpentanoate (PubChem CID 154505737) has the molecular formula C18H23ClFN3O2 and a molecular weight of 367.85 g/mol. Its IUPAC name is ethyl (3R)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-4-cyclopentylpentanoate.
| Compound Name | ethyl (3R)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-4-cyclopentylpentanoate |
|---|---|
| PubChem CID | 154505737 |
| Molecular Formula | C18H23ClFN3O2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl (3R)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-4-cyclopentylpentanoate |
| SMILES | CCOC(=O)C[C@@H](Nc1nc(Cl)c(C#N)cc1F)C(C)C1CCCC1 |
| InChI | InChI=1S/C18H23ClFN3O2/c1-3-25-16(24)9-15(11(2)12-6-4-5-7-12)22-18-14(20)8-13(10-21)17(19)23-18/h8,11-12,15H,3-7,9H2,1-2H3,(H,22,23)/t11?,15-/m1/s1 |
| InChIKey | YJVQVHZUZGLMLN-JOPIAHFSSA-N |
| XLogP | 4.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|