C14H18ClFN4O3 — CID 152815387
tert-butyl N-[(1S)-2-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-1-hydroxypropyl]carbamate (PubChem CID 152815387) has the molecular formula C14H18ClFN4O3 and a molecular weight of 344.77 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-1-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-1-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 152815387 |
| Molecular Formula | C14H18ClFN4O3 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]-1-hydroxypropyl]carbamate |
| SMILES | CC(Nc1nc(Cl)c(C#N)cc1F)[C@H](O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18ClFN4O3/c1-7(12(21)20-13(22)23-14(2,3)4)18-11-9(16)5-8(6-17)10(15)19-11/h5,7,12,21H,1-4H3,(H,18,19)(H,20,22)/t7?,12-/m0/s1 |
| InChIKey | SSGVECNXNXWTFE-LRUBCLLZSA-N |
| XLogP | 2.39 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|